C27H38O5S — CID 88685751
3-[(7R,8S,9S,10R,13S,14S,17R)-7-(2,2-dimethylpropanoylsulfanyl)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid (PubChem CID 88685751) has the molecular formula C27H38O5S and a molecular weight of 474.66 g/mol. Its IUPAC name is 3-[(7R,8S,9S,10R,13S,14S,17R)-7-(2,2-dimethylpropanoylsulfanyl)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid.
| Compound Name | 3-[(7R,8S,9S,10R,13S,14S,17R)-7-(2,2-dimethylpropanoylsulfanyl)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid |
|---|---|
| PubChem CID | 88685751 |
| Molecular Formula | C27H38O5S |
| Molecular Weight | 474.66 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 3-[(7R,8S,9S,10R,13S,14S,17R)-7-(2,2-dimethylpropanoylsulfanyl)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid |
| SMILES | CC(C)(C)C(=O)S[C@@H]1CC2=CC(=O)CC[C@]2(C)[C@H]2C=C[C@@]3(C)[C@@H](CC[C@@]3(O)CCC(=O)O)[C@H]12 |
| InChI | InChI=1S/C27H38O5S/c1-24(2,3)23(31)33-20-15-16-14-17(28)6-10-25(16,4)18-7-11-26(5)19(22(18)20)8-12-27(26,32)13-9-21(29)30/h7,11,14,18-20,22,32H,6,8-10,12-13,15H2,1-5H3,(H,29,30)/t18-,19-,20+,22+,25-,26-,27+/m0/s1 |
| InChIKey | DSDXJMNGTRLREY-IXBXZANLSA-N |
| XLogP | 5.17 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|