C14H28N4O4 — CID 88686240
2-[1-(carboxymethyl)-4,8,11-triaza-1-azoniacyclotetradec-1-yl]acetate (PubChem CID 88686240) has the molecular formula C14H28N4O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[1-(carboxymethyl)-4,8,11-triaza-1-azoniacyclotetradec-1-yl]acetate.
| Compound Name | 2-[1-(carboxymethyl)-4,8,11-triaza-1-azoniacyclotetradec-1-yl]acetate |
|---|---|
| PubChem CID | 88686240 |
| Molecular Formula | C14H28N4O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 2-[1-(carboxymethyl)-4,8,11-triaza-1-azoniacyclotetradec-1-yl]acetate |
| SMILES | O=C([O-])C[N+]1(CC(=O)O)CCCNCCNCCCNCC1 |
| InChI | InChI=1S/C14H28N4O4/c19-13(20)11-18(12-14(21)22)9-2-5-16-7-6-15-3-1-4-17-8-10-18/h15-17H,1-12H2,(H-,19,20,21,22) |
| InChIKey | FKCOIWOYAWBQTI-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|