C8H16N2O2 — CID 68851234
1-ethyl-1,4-diazepan-1-ium-1-carboxylate (PubChem CID 68851234) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-ethyl-1,4-diazepan-1-ium-1-carboxylate.
| Compound Name | 1-ethyl-1,4-diazepan-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 68851234 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 1-ethyl-1,4-diazepan-1-ium-1-carboxylate |
| SMILES | CC[N+]1(C(=O)[O-])CCCNCC1 |
| InChI | InChI=1S/C8H16N2O2/c1-2-10(8(11)12)6-3-4-9-5-7-10/h9H,2-7H2,1H3 |
| InChIKey | ORQJQZOWJXJNRS-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|