C8H18N3O+ — CID 91203729
1-ethyl-1,4-diazepan-1-ium-1-carboxamide (PubChem CID 91203729) has the molecular formula C8H18N3O+ and a molecular weight of 172.25 g/mol. Its IUPAC name is 1-ethyl-1,4-diazepan-1-ium-1-carboxamide.
| Compound Name | 1-ethyl-1,4-diazepan-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 91203729 |
| Molecular Formula | C8H18N3O+ |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | 1-ethyl-1,4-diazepan-1-ium-1-carboxamide |
| SMILES | CC[N+]1(C(N)=O)CCCNCC1 |
| InChI | InChI=1S/C8H17N3O/c1-2-11(8(9)12)6-3-4-10-5-7-11/h10H,2-7H2,1H3,(H-,9,12)/p+1 |
| InChIKey | BFJYFEOANOIUOQ-UHFFFAOYSA-O |
| XLogP | -0.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|