C8H17N3O3 — CID 88686252
1-aminopropan-2-yl (2S)-2,5-diamino-5-oxopentanoate (PubChem CID 88686252) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-aminopropan-2-yl (2S)-2,5-diamino-5-oxopentanoate.
| Compound Name | 1-aminopropan-2-yl (2S)-2,5-diamino-5-oxopentanoate |
|---|---|
| PubChem CID | 88686252 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-aminopropan-2-yl (2S)-2,5-diamino-5-oxopentanoate |
| SMILES | CC(CN)OC(=O)[C@@H](N)CCC(N)=O |
| InChI | InChI=1S/C8H17N3O3/c1-5(4-9)14-8(13)6(10)2-3-7(11)12/h5-6H,2-4,9-10H2,1H3,(H2,11,12)/t5?,6-/m0/s1 |
| InChIKey | RUGVQHCWFWZCRH-GDVGLLTNSA-N |
| XLogP | -1.53 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |