C11H15ClO4 — CID 88688180
[(3Z)-1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl] acetate (PubChem CID 88688180) has the molecular formula C11H15ClO4 and a molecular weight of 246.69 g/mol. Its IUPAC name is [(3Z)-1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl] acetate.
| Compound Name | [(3Z)-1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl] acetate |
|---|---|
| PubChem CID | 88688180 |
| Molecular Formula | C11H15ClO4 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | [(3Z)-1-acetyloxy-1-chloro-3-methylhexa-3,5-dien-2-yl] acetate |
| SMILES | C=C/C=C(/C)C(OC(C)=O)C(Cl)OC(C)=O |
| InChI | InChI=1S/C11H15ClO4/c1-5-6-7(2)10(15-8(3)13)11(12)16-9(4)14/h5-6,10-11H,1H2,2-4H3/b7-6- |
| InChIKey | MUBQTZFKGBFVPT-SREVYHEPSA-N |
| XLogP | 2.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|