C14H19ClO5 — CID 101264198
[(2R,3S,6R)-3-acetyloxy-6-[2-(chloromethyl)prop-2-enyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 101264198) has the molecular formula C14H19ClO5 and a molecular weight of 302.75 g/mol. Its IUPAC name is [(2R,3S,6R)-3-acetyloxy-6-[2-(chloromethyl)prop-2-enyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3-acetyloxy-6-[2-(chloromethyl)prop-2-enyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101264198 |
| Molecular Formula | C14H19ClO5 |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [(2R,3S,6R)-3-acetyloxy-6-[2-(chloromethyl)prop-2-enyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | C=C(CCl)C[C@@H]1C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C14H19ClO5/c1-9(7-15)6-12-4-5-13(19-11(3)17)14(20-12)8-18-10(2)16/h4-5,12-14H,1,6-8H2,2-3H3/t12-,13-,14+/m0/s1 |
| InChIKey | HDUHLZLFABPZSP-MELADBBJSA-N |
| XLogP | 1.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|