C14H15ClO5 — CID 11033879
[(2R,3S,6S)-3-acetyloxy-6-[(Z)-4-chlorobut-3-en-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 11033879) has the molecular formula C14H15ClO5 and a molecular weight of 298.72 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-[(Z)-4-chlorobut-3-en-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-[(Z)-4-chlorobut-3-en-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11033879 |
| Molecular Formula | C14H15ClO5 |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-[(Z)-4-chlorobut-3-en-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C#C/C=C\Cl)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H15ClO5/c1-10(16)18-9-14-13(19-11(2)17)7-6-12(20-14)5-3-4-8-15/h4,6-8,12-14H,9H2,1-2H3/b8-4-/t12-,13+,14-/m1/s1 |
| InChIKey | OXDZIDOILVFMCR-OWJDCLKYSA-N |
| XLogP | 1.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|