C11H10F3NO — CID 88688295
N-(6,7-dihydro-3H-inden-4-yl)-2,2,2-trifluoroacetamide (PubChem CID 88688295) has the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. Its IUPAC name is N-(6,7-dihydro-3H-inden-4-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(6,7-dihydro-3H-inden-4-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88688295 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-(6,7-dihydro-3H-inden-4-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NC1=CCCC2=C1CC=C2)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO/c12-11(13,14)10(16)15-9-6-2-4-7-3-1-5-8(7)9/h1,3,6H,2,4-5H2,(H,15,16) |
| InChIKey | QSILQVNZVRMMSF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |