C10H14N2O4S2 — CID 88689407
2-[(4-aminophenyl)-methylsulfamoyl]-3-sulfanylpropanoic acid (PubChem CID 88689407) has the molecular formula C10H14N2O4S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[(4-aminophenyl)-methylsulfamoyl]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(4-aminophenyl)-methylsulfamoyl]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 88689407 |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-[(4-aminophenyl)-methylsulfamoyl]-3-sulfanylpropanoic acid |
| SMILES | CN(c1ccc(N)cc1)S(=O)(=O)C(CS)C(=O)O |
| InChI | InChI=1S/C10H14N2O4S2/c1-12(8-4-2-7(11)3-5-8)18(15,16)9(6-17)10(13)14/h2-5,9,17H,6,11H2,1H3,(H,13,14) |
| InChIKey | XMUYUQYJQMKSCH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|