C9H11NO4S2 — CID 57213344
2-(4-aminophenyl)sulfonyl-3-sulfanylpropanoic acid (PubChem CID 57213344) has the molecular formula C9H11NO4S2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(4-aminophenyl)sulfonyl-3-sulfanylpropanoic acid.
| Compound Name | 2-(4-aminophenyl)sulfonyl-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 57213344 |
| Molecular Formula | C9H11NO4S2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 2-(4-aminophenyl)sulfonyl-3-sulfanylpropanoic acid |
| SMILES | Nc1ccc(S(=O)(=O)C(CS)C(=O)O)cc1 |
| InChI | InChI=1S/C9H11NO4S2/c10-6-1-3-7(4-2-6)16(13,14)8(5-15)9(11)12/h1-4,8,15H,5,10H2,(H,11,12) |
| InChIKey | QKTHHFZUENAVQF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|