C17H20N4O9 — CID 88690392
[1-[1,3-dioxo-5-(2-pyrrolidin-1-ylethoxy)isoindol-2-yl]-3-nitrooxypropan-2-yl] nitrate (PubChem CID 88690392) has the molecular formula C17H20N4O9 and a molecular weight of 424.37 g/mol. Its IUPAC name is [1-[1,3-dioxo-5-(2-pyrrolidin-1-ylethoxy)isoindol-2-yl]-3-nitrooxypropan-2-yl] nitrate.
| Compound Name | [1-[1,3-dioxo-5-(2-pyrrolidin-1-ylethoxy)isoindol-2-yl]-3-nitrooxypropan-2-yl] nitrate |
|---|---|
| PubChem CID | 88690392 |
| Molecular Formula | C17H20N4O9 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | [1-[1,3-dioxo-5-(2-pyrrolidin-1-ylethoxy)isoindol-2-yl]-3-nitrooxypropan-2-yl] nitrate |
| SMILES | O=C1c2ccc(OCCN3CCCC3)cc2C(=O)N1CC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N4O9/c22-16-14-4-3-12(28-8-7-18-5-1-2-6-18)9-15(14)17(23)19(16)10-13(30-21(26)27)11-29-20(24)25/h3-4,9,13H,1-2,5-8,10-11H2 |
| InChIKey | VTXRRBFDZIINDD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 154.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|