C20H18O8 — CID 88698744
1-O,4-O-bis(2-methylprop-2-enoyl) 2-O-[(Z)-prop-1-enyl] benzene-1,2,4-tricarboxylate (PubChem CID 88698744) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is 1-O,4-O-bis(2-methylprop-2-enoyl) 2-O-[(Z)-prop-1-enyl] benzene-1,2,4-tricarboxylate.
| Compound Name | 1-O,4-O-bis(2-methylprop-2-enoyl) 2-O-[(Z)-prop-1-enyl] benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 88698744 |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-O,4-O-bis(2-methylprop-2-enoyl) 2-O-[(Z)-prop-1-enyl] benzene-1,2,4-tricarboxylate |
| SMILES | C=C(C)C(=O)OC(=O)c1ccc(C(=O)OC(=O)C(=C)C)c(C(=O)O/C=C\C)c1 |
| InChI | InChI=1S/C20H18O8/c1-6-9-26-19(24)15-10-13(18(23)27-16(21)11(2)3)7-8-14(15)20(25)28-17(22)12(4)5/h6-10H,2,4H2,1,3,5H3/b9-6- |
| InChIKey | KIHGCWGJRSWRCD-TWGQIWQCSA-N |
| XLogP | 2.90 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|