C26H30O12 — CID 88725263
2-O,4-O-bis[2-hydroxy-1-(2-methylprop-2-enoyloxy)propyl] 1-O-[(E)-prop-1-enyl] benzene-1,2,4-tricarboxylate (PubChem CID 88725263) has the molecular formula C26H30O12 and a molecular weight of 534.51 g/mol. Its IUPAC name is 2-O,4-O-bis[2-hydroxy-1-(2-methylprop-2-enoyloxy)propyl] 1-O-[(E)-prop-1-enyl] benzene-1,2,4-tricarboxylate.
| Compound Name | 2-O,4-O-bis[2-hydroxy-1-(2-methylprop-2-enoyloxy)propyl] 1-O-[(E)-prop-1-enyl] benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 88725263 |
| Molecular Formula | C26H30O12 |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 2-O,4-O-bis[2-hydroxy-1-(2-methylprop-2-enoyloxy)propyl] 1-O-[(E)-prop-1-enyl] benzene-1,2,4-tricarboxylate |
| SMILES | C=C(C)C(=O)OC(OC(=O)c1ccc(C(=O)O/C=C/C)c(C(=O)OC(OC(=O)C(=C)C)C(C)O)c1)C(C)O |
| InChI | InChI=1S/C26H30O12/c1-8-11-34-23(32)18-10-9-17(22(31)37-25(15(6)27)35-20(29)13(2)3)12-19(18)24(33)38-26(16(7)28)36-21(30)14(4)5/h8-12,15-16,25-28H,2,4H2,1,3,5-7H3/b11-8+ |
| InChIKey | PXTUQBGMNJECKN-DHZHZOJOSA-N |
| XLogP | 2.34 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|