C24H36O9 — CID 58999421
tris(1-propan-2-yloxyethyl) benzene-1,2,4-tricarboxylate (PubChem CID 58999421) has the molecular formula C24H36O9 and a molecular weight of 468.54 g/mol. Its IUPAC name is tris(1-propan-2-yloxyethyl) benzene-1,2,4-tricarboxylate.
| Compound Name | tris(1-propan-2-yloxyethyl) benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 58999421 |
| Molecular Formula | C24H36O9 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | tris(1-propan-2-yloxyethyl) benzene-1,2,4-tricarboxylate |
| SMILES | CC(C)OC(C)OC(=O)c1ccc(C(=O)OC(C)OC(C)C)c(C(=O)OC(C)OC(C)C)c1 |
| InChI | InChI=1S/C24H36O9/c1-13(2)28-16(7)31-22(25)19-10-11-20(23(26)32-17(8)29-14(3)4)21(12-19)24(27)33-18(9)30-15(5)6/h10-18H,1-9H3 |
| InChIKey | IRAUDJJGXUWJQY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|