C16H16O8 — CID 54338839
2-(2-hydroxy-5-methyl-4-oxohex-5-en-3-yl)oxycarbonylterephthalic acid (PubChem CID 54338839) has the molecular formula C16H16O8 and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-(2-hydroxy-5-methyl-4-oxohex-5-en-3-yl)oxycarbonylterephthalic acid.
| Compound Name | 2-(2-hydroxy-5-methyl-4-oxohex-5-en-3-yl)oxycarbonylterephthalic acid |
|---|---|
| PubChem CID | 54338839 |
| Molecular Formula | C16H16O8 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-(2-hydroxy-5-methyl-4-oxohex-5-en-3-yl)oxycarbonylterephthalic acid |
| SMILES | C=C(C)C(=O)C(OC(=O)c1cc(C(=O)O)ccc1C(=O)O)C(C)O |
| InChI | InChI=1S/C16H16O8/c1-7(2)12(18)13(8(3)17)24-16(23)11-6-9(14(19)20)4-5-10(11)15(21)22/h4-6,8,13,17H,1H2,2-3H3,(H,19,20)(H,21,22) |
| InChIKey | TXMDYVABLNJKBW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|