C11H8BrCl2NO2 — CID 88700138
N-(2-bromophenyl)-5,5-dichloro-3-oxopent-4-enamide (PubChem CID 88700138) has the molecular formula C11H8BrCl2NO2 and a molecular weight of 337.00 g/mol. Its IUPAC name is N-(2-bromophenyl)-5,5-dichloro-3-oxopent-4-enamide.
| Compound Name | N-(2-bromophenyl)-5,5-dichloro-3-oxopent-4-enamide |
|---|---|
| PubChem CID | 88700138 |
| Molecular Formula | C11H8BrCl2NO2 |
| Molecular Weight | 337.00 g/mol |
| Exact Mass | 334.91 |
| IUPAC Name | N-(2-bromophenyl)-5,5-dichloro-3-oxopent-4-enamide |
| SMILES | O=C(C=C(Cl)Cl)CC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C11H8BrCl2NO2/c12-8-3-1-2-4-9(8)15-11(17)6-7(16)5-10(13)14/h1-5H,6H2,(H,15,17) |
| InChIKey | LUVIKZWYZDZNMC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.00 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|