C14H27N3OS — CID 88701738
3-oxo-N,2-dipentylpyrazolidine-1-carbothioamide (PubChem CID 88701738) has the molecular formula C14H27N3OS and a molecular weight of 285.46 g/mol. Its IUPAC name is 3-oxo-N,2-dipentylpyrazolidine-1-carbothioamide.
| Compound Name | 3-oxo-N,2-dipentylpyrazolidine-1-carbothioamide |
|---|---|
| PubChem CID | 88701738 |
| Molecular Formula | C14H27N3OS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 3-oxo-N,2-dipentylpyrazolidine-1-carbothioamide |
| SMILES | CCCCCNC(=S)N1CCC(=O)N1CCCCC |
| InChI | InChI=1S/C14H27N3OS/c1-3-5-7-10-15-14(19)17-12-9-13(18)16(17)11-8-6-4-2/h3-12H2,1-2H3,(H,15,19) |
| InChIKey | URXKWGMWBUVUBG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|