C11H19N3O4 — CID 87547939
(3-methyl-2,5-dioxoimidazolidin-1-yl) N-hexylcarbamate (PubChem CID 87547939) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is (3-methyl-2,5-dioxoimidazolidin-1-yl) N-hexylcarbamate.
| Compound Name | (3-methyl-2,5-dioxoimidazolidin-1-yl) N-hexylcarbamate |
|---|---|
| PubChem CID | 87547939 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (3-methyl-2,5-dioxoimidazolidin-1-yl) N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)ON1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C11H19N3O4/c1-3-4-5-6-7-12-10(16)18-14-9(15)8-13(2)11(14)17/h3-8H2,1-2H3,(H,12,16) |
| InChIKey | DTLUBNAACNKVOU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|