C18H26N2O4 — CID 91163668
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) N-octylcarbamate (PubChem CID 91163668) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) N-octylcarbamate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) N-octylcarbamate |
|---|---|
| PubChem CID | 91163668 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) N-octylcarbamate |
| SMILES | CCCCCCCCNC(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C18H26N2O4/c1-2-3-4-5-6-7-10-19-18(23)24-20-16(21)14-12-8-9-13(11-12)15(14)17(20)22/h8-9,12-13,21-22H,2-7,10-11H2,1H3,(H,19,23) |
| InChIKey | CLPGHCCGRJFEAO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|