C5H10NO2S- — CID 88701923
2,2-dimethyl-4-oxido-1,3,4-oxathiazinane (PubChem CID 88701923) has the molecular formula C5H10NO2S- and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,2-dimethyl-4-oxido-1,3,4-oxathiazinane.
| Compound Name | 2,2-dimethyl-4-oxido-1,3,4-oxathiazinane |
|---|---|
| PubChem CID | 88701923 |
| Molecular Formula | C5H10NO2S- |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 2,2-dimethyl-4-oxido-1,3,4-oxathiazinane |
| SMILES | CC1(C)OCCN([O-])S1 |
| InChI | InChI=1S/C5H10NO2S/c1-5(2)8-4-3-6(7)9-5/h3-4H2,1-2H3/q-1 |
| InChIKey | OGDZVZLBYNKJJH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|