C4H8NO2S- — CID 88702496
2-methyl-4-oxido-1,3,4-oxathiazinane (PubChem CID 88702496) has the molecular formula C4H8NO2S- and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-methyl-4-oxido-1,3,4-oxathiazinane.
| Compound Name | 2-methyl-4-oxido-1,3,4-oxathiazinane |
|---|---|
| PubChem CID | 88702496 |
| Molecular Formula | C4H8NO2S- |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | 2-methyl-4-oxido-1,3,4-oxathiazinane |
| SMILES | CC1OCCN([O-])S1 |
| InChI | InChI=1S/C4H8NO2S/c1-4-7-3-2-5(6)8-4/h4H,2-3H2,1H3/q-1 |
| InChIKey | MCYCYIOAKDCUNJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|