C22H18ClNO2 — CID 88705198
(Z)-3-(8-chloro-1-phenyl-3H-2-benzazepin-5-yl)hex-2-en-4-yne-1,6-diol (PubChem CID 88705198) has the molecular formula C22H18ClNO2 and a molecular weight of 363.84 g/mol. Its IUPAC name is (Z)-3-(8-chloro-1-phenyl-3H-2-benzazepin-5-yl)hex-2-en-4-yne-1,6-diol.
| Compound Name | (Z)-3-(8-chloro-1-phenyl-3H-2-benzazepin-5-yl)hex-2-en-4-yne-1,6-diol |
|---|---|
| PubChem CID | 88705198 |
| Molecular Formula | C22H18ClNO2 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (Z)-3-(8-chloro-1-phenyl-3H-2-benzazepin-5-yl)hex-2-en-4-yne-1,6-diol |
| SMILES | OCC#C/C(=C/CO)C1=CCN=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H18ClNO2/c23-18-8-9-20-19(16(11-14-26)7-4-13-25)10-12-24-22(21(20)15-18)17-5-2-1-3-6-17/h1-3,5-6,8-11,15,25-26H,12-14H2/b16-11- |
| InChIKey | BRQHVGJHMFNPBM-WJDWOHSUSA-N |
| XLogP | 3.49 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|