C10H11NNa2O9S2 — CID 88705498
disodium;3-(hydroxymethylsulfinyl)-7-oxo-6-(1-sulfonatooxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 88705498) has the molecular formula C10H11NNa2O9S2 and a molecular weight of 399.31 g/mol. Its IUPAC name is disodium;3-(hydroxymethylsulfinyl)-7-oxo-6-(1-sulfonatooxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | disodium;3-(hydroxymethylsulfinyl)-7-oxo-6-(1-sulfonatooxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88705498 |
| Molecular Formula | C10H11NNa2O9S2 |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | disodium;3-(hydroxymethylsulfinyl)-7-oxo-6-(1-sulfonatooxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(OS(=O)(=O)[O-])C1C(=O)N2C(C(=O)[O-])=C(S(=O)CO)CC12.[Na+].[Na+] |
| InChI | InChI=1S/C10H13NO9S2.2Na/c1-4(20-22(17,18)19)7-5-2-6(21(16)3-12)8(10(14)15)11(5)9(7)13;;/h4-5,7,12H,2-3H2,1H3,(H,14,15)(H,17,18,19);;/q;2*+1/p-2 |
| InChIKey | JBLWOWDGSJIHMW-UHFFFAOYSA-L |
| XLogP | -9.25 |
| TPSA | 164.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | -9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|