C19H26N7O5S+ — CID 88707929
[(6S)-7-[[2-(4-aminopyrimidin-2-yl)-2-ethoxyiminoacetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-trimethylazanium (PubChem CID 88707929) has the molecular formula C19H26N7O5S+ and a molecular weight of 464.53 g/mol. Its IUPAC name is [(6S)-7-[[2-(4-aminopyrimidin-2-yl)-2-ethoxyiminoacetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-trimethylazanium.
| Compound Name | [(6S)-7-[[2-(4-aminopyrimidin-2-yl)-2-ethoxyiminoacetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 88707929 |
| Molecular Formula | C19H26N7O5S+ |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | [(6S)-7-[[2-(4-aminopyrimidin-2-yl)-2-ethoxyiminoacetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-trimethylazanium |
| SMILES | CCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C[N+](C)(C)C)CS[C@@H]12)c1nccc(N)n1 |
| InChI | InChI=1S/C19H25N7O5S/c1-5-31-24-12(15-21-7-6-11(20)22-15)16(27)23-13-17(28)25-14(19(29)30)10(8-26(2,3)4)9-32-18(13)25/h6-7,13,18H,5,8-9H2,1-4H3,(H3-,20,21,22,23,27,29,30)/p+1/t13?,18-/m0/s1 |
| InChIKey | XTJDZLRYHAZHQA-UWBLVGDVSA-O |
| XLogP | -0.76 |
| TPSA | 160.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|