C17H15FN6O3 — CID 8870849
4-fluoro-N'-[2-[5-(phenoxymethyl)tetrazol-2-yl]acetyl]benzohydrazide (PubChem CID 8870849) has the molecular formula C17H15FN6O3 and a molecular weight of 370.34 g/mol. Its IUPAC name is 4-fluoro-N'-[2-[5-(phenoxymethyl)tetrazol-2-yl]acetyl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[2-[5-(phenoxymethyl)tetrazol-2-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8870849 |
| Molecular Formula | C17H15FN6O3 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-fluoro-N'-[2-[5-(phenoxymethyl)tetrazol-2-yl]acetyl]benzohydrazide |
| SMILES | O=C(Cn1nnc(COc2ccccc2)n1)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN6O3/c18-13-8-6-12(7-9-13)17(26)21-20-16(25)10-24-22-15(19-23-24)11-27-14-4-2-1-3-5-14/h1-9H,10-11H2,(H,20,25)(H,21,26) |
| InChIKey | JRYRRHWLBUSNRU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|