C21H23N7O3 — CID 8969759
2-(3,4-dihydro-2H-quinolin-1-yl)-N'-[2-[5-(phenoxymethyl)tetrazol-2-yl]acetyl]acetohydrazide (PubChem CID 8969759) has the molecular formula C21H23N7O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-N'-[2-[5-(phenoxymethyl)tetrazol-2-yl]acetyl]acetohydrazide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N'-[2-[5-(phenoxymethyl)tetrazol-2-yl]acetyl]acetohydrazide |
|---|---|
| PubChem CID | 8969759 |
| Molecular Formula | C21H23N7O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N'-[2-[5-(phenoxymethyl)tetrazol-2-yl]acetyl]acetohydrazide |
| SMILES | O=C(CN1CCCc2ccccc21)NNC(=O)Cn1nnc(COc2ccccc2)n1 |
| InChI | InChI=1S/C21H23N7O3/c29-20(13-27-12-6-8-16-7-4-5-11-18(16)27)23-24-21(30)14-28-25-19(22-26-28)15-31-17-9-2-1-3-10-17/h1-5,7,9-11H,6,8,12-15H2,(H,23,29)(H,24,30) |
| InChIKey | QERSEDYKAURLPO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|