C18H26ClN3O3S — CID 88708993
3-[2-(4-chlorophenyl)-1-sulfonylethyl]-N-[2-(dimethylamino)ethyl]piperidine-1-carboxamide (PubChem CID 88708993) has the molecular formula C18H26ClN3O3S and a molecular weight of 399.94 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-1-sulfonylethyl]-N-[2-(dimethylamino)ethyl]piperidine-1-carboxamide.
| Compound Name | 3-[2-(4-chlorophenyl)-1-sulfonylethyl]-N-[2-(dimethylamino)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 88708993 |
| Molecular Formula | C18H26ClN3O3S |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-1-sulfonylethyl]-N-[2-(dimethylamino)ethyl]piperidine-1-carboxamide |
| SMILES | CN(C)CCNC(=O)N1CCCC(C(Cc2ccc(Cl)cc2)=S(=O)=O)C1 |
| InChI | InChI=1S/C18H26ClN3O3S/c1-21(2)11-9-20-18(23)22-10-3-4-15(13-22)17(26(24)25)12-14-5-7-16(19)8-6-14/h5-8,15H,3-4,9-13H2,1-2H3,(H,20,23) |
| InChIKey | HJVJLBJRJHXRQA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|