C8H9NO2S — CID 88709358
4-ethenyl-6-sulfonylcyclohexa-2,4-dien-1-amine (PubChem CID 88709358) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is 4-ethenyl-6-sulfonylcyclohexa-2,4-dien-1-amine.
| Compound Name | 4-ethenyl-6-sulfonylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 88709358 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 4-ethenyl-6-sulfonylcyclohexa-2,4-dien-1-amine |
| SMILES | C=CC1=CC(=S(=O)=O)C(N)C=C1 |
| InChI | InChI=1S/C8H9NO2S/c1-2-6-3-4-7(9)8(5-6)12(10)11/h2-5,7H,1,9H2 |
| InChIKey | ZMFQWVUFQAMVMF-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|