C5H5ClO — CID 88712222
4-chloro-2-methylbuta-1,3-dien-1-one (PubChem CID 88712222) has the molecular formula C5H5ClO and a molecular weight of 116.55 g/mol. Its IUPAC name is 4-chloro-2-methylbuta-1,3-dien-1-one.
| Compound Name | 4-chloro-2-methylbuta-1,3-dien-1-one |
|---|---|
| PubChem CID | 88712222 |
| Molecular Formula | C5H5ClO |
| Molecular Weight | 116.55 g/mol |
| Exact Mass | 116.00 |
| IUPAC Name | 4-chloro-2-methylbuta-1,3-dien-1-one |
| SMILES | CC(=C=O)C=CCl |
| InChI | InChI=1S/C5H5ClO/c1-5(4-7)2-3-6/h2-3H,1H3 |
| InChIKey | YLDLXAAWTCNHKA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|