About 2-methylprop-1-en-1-one;molecular iodine
2-methylprop-1-en-1-one;molecular iodine (PubChem CID 157139585) has the molecular formula C4H6I2O
and a molecular weight of 323.90 g/mol. Its IUPAC name is 2-methylprop-1-en-1-one;molecular iodine.
Molecular Properties
| Compound Name | 2-methylprop-1-en-1-one;molecular iodine |
| PubChem CID | 157139585 |
| Molecular Formula | C4H6I2O |
| Molecular Weight | 323.90 g/mol |
| Exact Mass | 323.85 |
| IUPAC Name | 2-methylprop-1-en-1-one;molecular iodine |
| SMILES | CC(C)=C=O.II |
| InChI | InChI=1S/C4H6O.I2/c1-4(2)3-5;1-2/h1-2H3; |
| InChIKey | AKAOSTBIKKWLSY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.90 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-en-1-one;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-en-1-one;molecular iodine?
The IUPAC name of 2-methylprop-1-en-1-one;molecular iodine (CID 157139585) is 2-methylprop-1-en-1-one;molecular iodine.
What is the SMILES notation for 2-methylprop-1-en-1-one;molecular iodine?
The canonical SMILES for 2-methylprop-1-en-1-one;molecular iodine is CC(C)=C=O.II.
What is the InChIKey of 2-methylprop-1-en-1-one;molecular iodine?
The InChIKey is AKAOSTBIKKWLSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O.I2/c1-4(2)3-5;1-2/h1-2H3;.
What are the key properties of 2-methylprop-1-en-1-one;molecular iodine?
2-methylprop-1-en-1-one;molecular iodine has a molecular weight of 323.90 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-en-1-one;molecular iodine is sourced from PubChem (CID 157139585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).