C26H44N2O10 — CID 88713618
dodeca-5,7-diyne-1,12-diol;bis(ethyl 2-(ethoxycarbonylamino)acetate) (PubChem CID 88713618) has the molecular formula C26H44N2O10 and a molecular weight of 544.64 g/mol. Its IUPAC name is dodeca-5,7-diyne-1,12-diol;bis(ethyl 2-(ethoxycarbonylamino)acetate).
| Compound Name | dodeca-5,7-diyne-1,12-diol;bis(ethyl 2-(ethoxycarbonylamino)acetate) |
|---|---|
| PubChem CID | 88713618 |
| Molecular Formula | C26H44N2O10 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | dodeca-5,7-diyne-1,12-diol;bis(ethyl 2-(ethoxycarbonylamino)acetate) |
| SMILES | CCOC(=O)CNC(=O)OCC.CCOC(=O)CNC(=O)OCC.OCCCCC#CC#CCCCCO |
| InChI | InChI=1S/C12H18O2.2C7H13NO4/c13-11-9-7-5-3-1-2-4-6-8-10-12-14;2*1-3-11-6(9)5-8-7(10)12-4-2/h13-14H,5-12H2;2*3-5H2,1-2H3,(H,8,10) |
| InChIKey | HZAXNLVJGMRHIZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|