C28H32N2O5 — CID 88785771
9-carbazol-9-ylnona-5,7-diyn-1-ol;ethyl 2-(ethoxycarbonylamino)acetate (PubChem CID 88785771) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is 9-carbazol-9-ylnona-5,7-diyn-1-ol;ethyl 2-(ethoxycarbonylamino)acetate.
| Compound Name | 9-carbazol-9-ylnona-5,7-diyn-1-ol;ethyl 2-(ethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 88785771 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 9-carbazol-9-ylnona-5,7-diyn-1-ol;ethyl 2-(ethoxycarbonylamino)acetate |
| SMILES | CCOC(=O)CNC(=O)OCC.OCCCCC#CC#CCn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C21H19NO.C7H13NO4/c23-17-11-5-3-1-2-4-10-16-22-20-14-8-6-12-18(20)19-13-7-9-15-21(19)22;1-3-11-6(9)5-8-7(10)12-4-2/h6-9,12-15,23H,3,5,11,16-17H2;3-5H2,1-2H3,(H,8,10) |
| InChIKey | SIDOWNHZSHYEQL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|