C42H62N2O3 — CID 88786133
9-carbazol-9-ylnona-5,7-diyn-1-ol;icosan-2-yl carbamate (PubChem CID 88786133) has the molecular formula C42H62N2O3 and a molecular weight of 642.97 g/mol. Its IUPAC name is 9-carbazol-9-ylnona-5,7-diyn-1-ol;icosan-2-yl carbamate.
| Compound Name | 9-carbazol-9-ylnona-5,7-diyn-1-ol;icosan-2-yl carbamate |
|---|---|
| PubChem CID | 88786133 |
| Molecular Formula | C42H62N2O3 |
| Molecular Weight | 642.97 g/mol |
| Exact Mass | 642.48 |
| IUPAC Name | 9-carbazol-9-ylnona-5,7-diyn-1-ol;icosan-2-yl carbamate |
| SMILES | CCCCCCCCCCCCCCCCCCC(C)OC(N)=O.OCCCCC#CC#CCn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C21H43NO2.C21H19NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)24-21(22)23;23-17-11-5-3-1-2-4-10-16-22-20-14-8-6-12-18(20)19-13-7-9-15-21(19)22/h20H,3-19H2,1-2H3,(H2,22,23);6-9,12-15,23H,3,5,11,16-17H2 |
| InChIKey | DFARHPWPNIGARI-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.97 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|