C25H36N2O3S — CID 88715467
(dicyclohexylamino) 1-(3-sulfanylpropanoyl)-3,4-dihydro-2H-quinoline-2-carboxylate (PubChem CID 88715467) has the molecular formula C25H36N2O3S and a molecular weight of 444.64 g/mol. Its IUPAC name is (dicyclohexylamino) 1-(3-sulfanylpropanoyl)-3,4-dihydro-2H-quinoline-2-carboxylate.
| Compound Name | (dicyclohexylamino) 1-(3-sulfanylpropanoyl)-3,4-dihydro-2H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 88715467 |
| Molecular Formula | C25H36N2O3S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | (dicyclohexylamino) 1-(3-sulfanylpropanoyl)-3,4-dihydro-2H-quinoline-2-carboxylate |
| SMILES | O=C(ON(C1CCCCC1)C1CCCCC1)C1CCc2ccccc2N1C(=O)CCS |
| InChI | InChI=1S/C25H36N2O3S/c28-24(17-18-31)26-22-14-8-7-9-19(22)15-16-23(26)25(29)30-27(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h7-9,14,20-21,23,31H,1-6,10-13,15-18H2 |
| InChIKey | LTFXIHRZNCVTRY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|