C16H15BrN2O3S — CID 8871549
[2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 5-bromopyridine-3-carboxylate (PubChem CID 8871549) has the molecular formula C16H15BrN2O3S and a molecular weight of 395.28 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 5-bromopyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 5-bromopyridine-3-carboxylate |
|---|---|
| PubChem CID | 8871549 |
| Molecular Formula | C16H15BrN2O3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 5-bromopyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cncc(Br)c1)NCCSc1ccccc1 |
| InChI | InChI=1S/C16H15BrN2O3S/c17-13-8-12(9-18-10-13)16(21)22-11-15(20)19-6-7-23-14-4-2-1-3-5-14/h1-5,8-10H,6-7,11H2,(H,19,20) |
| InChIKey | YRGSPPANNSDQOU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|