C30H33N3O9S — CID 88715727
(2E)-2-[5-[1-amino-2-[3-benzhydryloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropoxy]-2-oxoethyl]thiophen-2-yl]-2-methoxyiminoacetic acid (PubChem CID 88715727) has the molecular formula C30H33N3O9S and a molecular weight of 611.67 g/mol. Its IUPAC name is (2E)-2-[5-[1-amino-2-[3-benzhydryloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropoxy]-2-oxoethyl]thiophen-2-yl]-2-methoxyiminoacetic acid.
| Compound Name | (2E)-2-[5-[1-amino-2-[3-benzhydryloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropoxy]-2-oxoethyl]thiophen-2-yl]-2-methoxyiminoacetic acid |
|---|---|
| PubChem CID | 88715727 |
| Molecular Formula | C30H33N3O9S |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | (2E)-2-[5-[1-amino-2-[3-benzhydryloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropoxy]-2-oxoethyl]thiophen-2-yl]-2-methoxyiminoacetic acid |
| SMILES | CO/N=C(\C(=O)O)c1ccc(C(N)C(=O)OCC(NC(=O)OC(C)(C)C)C(=O)OC(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C30H33N3O9S/c1-30(2,3)42-29(38)32-20(27(36)41-25(18-11-7-5-8-12-18)19-13-9-6-10-14-19)17-40-28(37)23(31)21-15-16-22(43-21)24(26(34)35)33-39-4/h5-16,20,23,25H,17,31H2,1-4H3,(H,32,38)(H,34,35)/b33-24- |
| InChIKey | VPPUIHSGLLJZDT-GIBOGKFOSA-N |
| XLogP | 3.95 |
| TPSA | 175.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|