C10H14Cl4O5 — CID 88720707
1-O-[3-chloro-1-(2-chloroethoxy)propyl] 2-O-(1,3-dichloropropyl) oxalate (PubChem CID 88720707) has the molecular formula C10H14Cl4O5 and a molecular weight of 356.03 g/mol. Its IUPAC name is 1-O-[3-chloro-1-(2-chloroethoxy)propyl] 2-O-(1,3-dichloropropyl) oxalate.
| Compound Name | 1-O-[3-chloro-1-(2-chloroethoxy)propyl] 2-O-(1,3-dichloropropyl) oxalate |
|---|---|
| PubChem CID | 88720707 |
| Molecular Formula | C10H14Cl4O5 |
| Molecular Weight | 356.03 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 1-O-[3-chloro-1-(2-chloroethoxy)propyl] 2-O-(1,3-dichloropropyl) oxalate |
| SMILES | O=C(OC(Cl)CCCl)C(=O)OC(CCCl)OCCCl |
| InChI | InChI=1S/C10H14Cl4O5/c11-3-1-7(14)18-9(15)10(16)19-8(2-4-12)17-6-5-13/h7-8H,1-6H2 |
| InChIKey | ZMAYGDMHXGMCQO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.03 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|