C10H8ClN3OS — CID 88720891
1-[(3-chlorophenyl)methylsulfanyl]-1,3,5-triazin-2-one (PubChem CID 88720891) has the molecular formula C10H8ClN3OS and a molecular weight of 253.71 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methylsulfanyl]-1,3,5-triazin-2-one.
| Compound Name | 1-[(3-chlorophenyl)methylsulfanyl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 88720891 |
| Molecular Formula | C10H8ClN3OS |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 1-[(3-chlorophenyl)methylsulfanyl]-1,3,5-triazin-2-one |
| SMILES | O=c1ncncn1SCc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H8ClN3OS/c11-9-3-1-2-8(4-9)5-16-14-7-12-6-13-10(14)15/h1-4,6-7H,5H2 |
| InChIKey | YNHOYPYTPUSHAX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |