C24H27N3O4S — CID 88723457
N-[3-[3-[(hexa-1,5-diynylamino)methyl]phenoxy]propyl]-3-(methanesulfonamido)benzamide (PubChem CID 88723457) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[3-[3-[(hexa-1,5-diynylamino)methyl]phenoxy]propyl]-3-(methanesulfonamido)benzamide.
| Compound Name | N-[3-[3-[(hexa-1,5-diynylamino)methyl]phenoxy]propyl]-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 88723457 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-[3-[3-[(hexa-1,5-diynylamino)methyl]phenoxy]propyl]-3-(methanesulfonamido)benzamide |
| SMILES | C#CCCC#CNCc1cccc(OCCCNC(=O)c2cccc(NS(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C24H27N3O4S/c1-3-4-5-6-14-25-19-20-10-7-13-23(17-20)31-16-9-15-26-24(28)21-11-8-12-22(18-21)27-32(2,29)30/h1,7-8,10-13,17-18,25,27H,4-5,9,15-16,19H2,2H3,(H,26,28) |
| InChIKey | YAZSKXPTQZWIAI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|