C26H39N3O4S — CID 70514062
N-[3-[3-[(dibutylamino)methyl]phenoxy]propyl]-3-(methanesulfonamido)benzamide (PubChem CID 70514062) has the molecular formula C26H39N3O4S and a molecular weight of 489.68 g/mol. Its IUPAC name is N-[3-[3-[(dibutylamino)methyl]phenoxy]propyl]-3-(methanesulfonamido)benzamide.
| Compound Name | N-[3-[3-[(dibutylamino)methyl]phenoxy]propyl]-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 70514062 |
| Molecular Formula | C26H39N3O4S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | N-[3-[3-[(dibutylamino)methyl]phenoxy]propyl]-3-(methanesulfonamido)benzamide |
| SMILES | CCCCN(CCCC)Cc1cccc(OCCCNC(=O)c2cccc(NS(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C26H39N3O4S/c1-4-6-16-29(17-7-5-2)21-22-11-8-14-25(19-22)33-18-10-15-27-26(30)23-12-9-13-24(20-23)28-34(3,31)32/h8-9,11-14,19-20,28H,4-7,10,15-18,21H2,1-3H3,(H,27,30) |
| InChIKey | SMSZZQYAGPKHGB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|