C19H21ClN2O3 — CID 88724929
3-[3-chloro-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)phenyl]-1-methoxy-1-methylurea (PubChem CID 88724929) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is 3-[3-chloro-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)phenyl]-1-methoxy-1-methylurea.
| Compound Name | 3-[3-chloro-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)phenyl]-1-methoxy-1-methylurea |
|---|---|
| PubChem CID | 88724929 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 3-[3-chloro-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)phenyl]-1-methoxy-1-methylurea |
| SMILES | CON(C)C(=O)Nc1ccc(Oc2ccc3c(c2)CCCC3)c(Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O3/c1-22(24-2)19(23)21-15-8-10-18(17(20)12-15)25-16-9-7-13-5-3-4-6-14(13)11-16/h7-12H,3-6H2,1-2H3,(H,21,23) |
| InChIKey | QXFHUCARVHJZRR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|