C19H16F4O7S — CID 88725569
7-hydroxy-3,4-dimethylchromen-2-one;4-(1,1,2,2-tetrafluoroethoxy)benzenesulfonic acid (PubChem CID 88725569) has the molecular formula C19H16F4O7S and a molecular weight of 464.39 g/mol. Its IUPAC name is 7-hydroxy-3,4-dimethylchromen-2-one;4-(1,1,2,2-tetrafluoroethoxy)benzenesulfonic acid.
| Compound Name | 7-hydroxy-3,4-dimethylchromen-2-one;4-(1,1,2,2-tetrafluoroethoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 88725569 |
| Molecular Formula | C19H16F4O7S |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 7-hydroxy-3,4-dimethylchromen-2-one;4-(1,1,2,2-tetrafluoroethoxy)benzenesulfonic acid |
| SMILES | Cc1c(C)c2ccc(O)cc2oc1=O.O=S(=O)(O)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C11H10O3.C8H6F4O4S/c1-6-7(2)11(13)14-10-5-8(12)3-4-9(6)10;9-7(10)8(11,12)16-5-1-3-6(4-2-5)17(13,14)15/h3-5,12H,1-2H3;1-4,7H,(H,13,14,15) |
| InChIKey | LVNGECWNCKFGCN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|