C11H10BrI2NO — CID 88726375
(E)-3-bromo-2,3-diiodo-N-[(2-methylphenyl)methyl]prop-2-enamide (PubChem CID 88726375) has the molecular formula C11H10BrI2NO and a molecular weight of 505.92 g/mol. Its IUPAC name is (E)-3-bromo-2,3-diiodo-N-[(2-methylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-bromo-2,3-diiodo-N-[(2-methylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 88726375 |
| Molecular Formula | C11H10BrI2NO |
| Molecular Weight | 505.92 g/mol |
| Exact Mass | 504.80 |
| IUPAC Name | (E)-3-bromo-2,3-diiodo-N-[(2-methylphenyl)methyl]prop-2-enamide |
| SMILES | Cc1ccccc1CNC(=O)/C(I)=C(/Br)I |
| InChI | InChI=1S/C11H10BrI2NO/c1-7-4-2-3-5-8(7)6-15-11(16)9(13)10(12)14/h2-5H,6H2,1H3,(H,15,16)/b10-9+ |
| InChIKey | WLGHDBFETRBTRG-MDZDMXLPSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.92 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|