C24H48O — CID 88727038
1,3-bis(2-ethylhexyl)cyclohexane;oxirane (PubChem CID 88727038) has the molecular formula C24H48O and a molecular weight of 352.65 g/mol. Its IUPAC name is 1,3-bis(2-ethylhexyl)cyclohexane;oxirane.
| Compound Name | 1,3-bis(2-ethylhexyl)cyclohexane;oxirane |
|---|---|
| PubChem CID | 88727038 |
| Molecular Formula | C24H48O |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.37 |
| IUPAC Name | 1,3-bis(2-ethylhexyl)cyclohexane;oxirane |
| SMILES | C1CO1.CCCCC(CC)CC1CCCC(CC(CC)CCCC)C1 |
| InChI | InChI=1S/C22H44.C2H4O/c1-5-9-12-19(7-3)16-21-14-11-15-22(18-21)17-20(8-4)13-10-6-2;1-2-3-1/h19-22H,5-18H2,1-4H3;1-2H2 |
| InChIKey | SGPNDTNXZRIRCV-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|