C14H20O10 — CID 88727821
1,2,3,4-tetramethylpentane-1,1,2,3,4-pentacarboxylic acid (PubChem CID 88727821) has the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. Its IUPAC name is 1,2,3,4-tetramethylpentane-1,1,2,3,4-pentacarboxylic acid.
| Compound Name | 1,2,3,4-tetramethylpentane-1,1,2,3,4-pentacarboxylic acid |
|---|---|
| PubChem CID | 88727821 |
| Molecular Formula | C14H20O10 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1,2,3,4-tetramethylpentane-1,1,2,3,4-pentacarboxylic acid |
| SMILES | CC(C)(C(=O)O)C(C)(C(=O)O)C(C)(C(=O)O)C(C)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H20O10/c1-11(2,6(15)16)13(4,9(21)22)14(5,10(23)24)12(3,7(17)18)8(19)20/h1-5H3,(H,15,16)(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | VBRXTPNDZWEEDT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|