C10H19NO6 — CID 88728406
3-(aziridin-1-yl)propanoic acid;ethane-1,2-diol;prop-2-enoic acid (PubChem CID 88728406) has the molecular formula C10H19NO6 and a molecular weight of 249.26 g/mol. Its IUPAC name is 3-(aziridin-1-yl)propanoic acid;ethane-1,2-diol;prop-2-enoic acid.
| Compound Name | 3-(aziridin-1-yl)propanoic acid;ethane-1,2-diol;prop-2-enoic acid |
|---|---|
| PubChem CID | 88728406 |
| Molecular Formula | C10H19NO6 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-(aziridin-1-yl)propanoic acid;ethane-1,2-diol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.O=C(O)CCN1CC1.OCCO |
| InChI | InChI=1S/C5H9NO2.C3H4O2.C2H6O2/c7-5(8)1-2-6-3-4-6;1-2-3(4)5;3-1-2-4/h1-4H2,(H,7,8);2H,1H2,(H,4,5);3-4H,1-2H2 |
| InChIKey | ZHBVMSBRICXWBT-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 118.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|