C17H24O5S5 — CID 88728795
1,4,7,10,13-pentaoxacyclodocosane-16,17,18,19,20-pentathione (PubChem CID 88728795) has the molecular formula C17H24O5S5 and a molecular weight of 468.71 g/mol. Its IUPAC name is 1,4,7,10,13-pentaoxacyclodocosane-16,17,18,19,20-pentathione.
| Compound Name | 1,4,7,10,13-pentaoxacyclodocosane-16,17,18,19,20-pentathione |
|---|---|
| PubChem CID | 88728795 |
| Molecular Formula | C17H24O5S5 |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 1,4,7,10,13-pentaoxacyclodocosane-16,17,18,19,20-pentathione |
| SMILES | S=C1CCOCCOCCOCCOCCOCCC(=S)C(=S)C(=S)C1=S |
| InChI | InChI=1S/C17H24O5S5/c23-13-1-3-18-5-7-20-9-11-22-12-10-21-8-6-19-4-2-14(24)16(26)17(27)15(13)25/h1-12H2 |
| InChIKey | VFUOOIIQMQFOFD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|