C13H22O3 — CID 88729487
(4,8-dimethyl-1-oxonon-7-en-4-yl) acetate (PubChem CID 88729487) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (4,8-dimethyl-1-oxonon-7-en-4-yl) acetate.
| Compound Name | (4,8-dimethyl-1-oxonon-7-en-4-yl) acetate |
|---|---|
| PubChem CID | 88729487 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (4,8-dimethyl-1-oxonon-7-en-4-yl) acetate |
| SMILES | CC(=O)OC(C)(CCC=O)CCC=C(C)C |
| InChI | InChI=1S/C13H22O3/c1-11(2)7-5-8-13(4,9-6-10-14)16-12(3)15/h7,10H,5-6,8-9H2,1-4H3 |
| InChIKey | KBOUIRQXTZQJAH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|