C22H27NO5 — CID 88730079
butyl prop-2-enoate;2-isocyanatoethyl 2-methylidene-5-phenylpent-4-enoate (PubChem CID 88730079) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is butyl prop-2-enoate;2-isocyanatoethyl 2-methylidene-5-phenylpent-4-enoate.
| Compound Name | butyl prop-2-enoate;2-isocyanatoethyl 2-methylidene-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 88730079 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | butyl prop-2-enoate;2-isocyanatoethyl 2-methylidene-5-phenylpent-4-enoate |
| SMILES | C=C(CC=Cc1ccccc1)C(=O)OCCN=C=O.C=CC(=O)OCCCC |
| InChI | InChI=1S/C15H15NO3.C7H12O2/c1-13(15(18)19-11-10-16-12-17)6-5-9-14-7-3-2-4-8-14;1-3-5-6-9-7(8)4-2/h2-5,7-9H,1,6,10-11H2;4H,2-3,5-6H2,1H3 |
| InChIKey | MBHUMRIIFOBACF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|